C12H14F3N3O2 — CID 118788732
N-methyl-N-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide (PubChem CID 118788732) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is N-methyl-N-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide.
| Compound Name | N-methyl-N-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 118788732 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-methyl-N-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide |
| SMILES | CC(=O)N(C)c1cccc(NC(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N3O2/c1-8(19)18(2)10-5-3-4-9(6-10)17-11(20)16-7-12(13,14)15/h3-6H,7H2,1-2H3,(H2,16,17,20) |
| InChIKey | JJMIZFIYMRXNQO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |