C13H16F3N3O2 — CID 74234598
N-methyl-3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanamide (PubChem CID 74234598) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is N-methyl-3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanamide.
| Compound Name | N-methyl-3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 74234598 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-methyl-3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanamide |
| SMILES | CNC(=O)CCc1cccc(NC(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3N3O2/c1-17-11(20)6-5-9-3-2-4-10(7-9)19-12(21)18-8-13(14,15)16/h2-4,7H,5-6,8H2,1H3,(H,17,20)(H2,18,19,21) |
| InChIKey | ZUHLNRZTVFRDMX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |