C14H17F3N2O3 — CID 75372926
ethyl 3-[4-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanoate (PubChem CID 75372926) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is ethyl 3-[4-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanoate.
| Compound Name | ethyl 3-[4-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 75372926 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | ethyl 3-[4-(2,2,2-trifluoroethylcarbamoylamino)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(NC(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-2-22-12(20)8-5-10-3-6-11(7-4-10)19-13(21)18-9-14(15,16)17/h3-4,6-7H,2,5,8-9H2,1H3,(H2,18,19,21) |
| InChIKey | XEYQTHGNTYTJHL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |