3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid

C12H14F2N2O3 — CID 113303949

IUPAC3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid
SMILESO=C(O)CCc1cccc(NC(=O)NCC(F)F)c1
InChIInChI=1S/C12H14F2N2O3/c13-10(14)7-15-12(19)16-9-3-1-2-8(6-9)4-5-11(17)18/h1-3,6,10H,4-5,7H2,(H,17,18)(H2,15,16,19)
InChIKeyZUZQPDQWELDERR-UHFFFAOYSA-N
MW272.25 g/mol
LogP2.09
Rot. Bonds6

About 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid

3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid (PubChem CID 113303949) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid.

Molecular Properties

Compound Name3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid
PubChem CID113303949
Molecular FormulaC12H14F2N2O3
Molecular Weight272.25 g/mol
Exact Mass272.10
IUPAC Name3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid
SMILESO=C(O)CCc1cccc(NC(=O)NCC(F)F)c1
InChIInChI=1S/C12H14F2N2O3/c13-10(14)7-15-12(19)16-9-3-1-2-8(6-9)4-5-11(17)18/h1-3,6,10H,4-5,7H2,(H,17,18)(H2,15,16,19)
InChIKeyZUZQPDQWELDERR-UHFFFAOYSA-N
XLogP2.09
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.25
LogP ≤ 52.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid?
The IUPAC name of 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid (CID 113303949) is 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid.
What is the SMILES notation for 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid?
The canonical SMILES for 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid is O=C(O)CCc1cccc(NC(=O)NCC(F)F)c1.
What is the InChIKey of 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid?
The InChIKey is ZUZQPDQWELDERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O3/c13-10(14)7-15-12(19)16-9-3-1-2-8(6-9)4-5-11(17)18/h1-3,6,10H,4-5,7H2,(H,17,18)(H2,15,16,19).
What are the key properties of 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid?
3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid has a molecular weight of 272.25 g/mol, XLogP of 2.09, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,2-difluoroethylcarbamoylamino)phenyl]propanoic acid is sourced from PubChem (CID 113303949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).