C19H31N5O2 — CID 126451419
N-methyl-N-[3-[[(3S)-3-(4-methylpiperazin-1-yl)butyl]carbamoylamino]phenyl]acetamide (PubChem CID 126451419) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-methyl-N-[3-[[(3S)-3-(4-methylpiperazin-1-yl)butyl]carbamoylamino]phenyl]acetamide.
| Compound Name | N-methyl-N-[3-[[(3S)-3-(4-methylpiperazin-1-yl)butyl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 126451419 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | N-methyl-N-[3-[[(3S)-3-(4-methylpiperazin-1-yl)butyl]carbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)N(C)c1cccc(NC(=O)NCC[C@H](C)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H31N5O2/c1-15(24-12-10-22(3)11-13-24)8-9-20-19(26)21-17-6-5-7-18(14-17)23(4)16(2)25/h5-7,14-15H,8-13H2,1-4H3,(H2,20,21,26)/t15-/m0/s1 |
| InChIKey | PGQYFQCWFHEHRY-HNNXBMFYSA-N |
| XLogP | 1.82 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |