About N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen
N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen (PubChem CID 162429371) has the molecular formula C10H17N3O2
and a molecular weight of 211.27 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen |
| PubChem CID | 162429371 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen |
| SMILES | CC(=O)N(C)c1cccc(NC(N)=O)c1.[H][H].[H][H] |
| InChI | InChI=1S/C10H13N3O2.2H2/c1-7(14)13(2)9-5-3-4-8(6-9)12-10(11)15;;/h3-6H,1-2H3,(H3,11,12,15);2*1H |
| InChIKey | VGIQXIPOLOKRNW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen?
The IUPAC name of N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen (CID 162429371) is N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen.
What is the SMILES notation for N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen?
The canonical SMILES for N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen is CC(=O)N(C)c1cccc(NC(N)=O)c1.[H][H].[H][H].
What is the InChIKey of N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen?
The InChIKey is VGIQXIPOLOKRNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2.2H2/c1-7(14)13(2)9-5-3-4-8(6-9)12-10(11)15;;/h3-6H,1-2H3,(H3,11,12,15);2*1H.
What are the key properties of N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen?
N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen has a molecular weight of 211.27 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(carbamoylamino)phenyl]-N-methylacetamide;molecular hydrogen is sourced from PubChem (CID 162429371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).