C18H20N2O4 — CID 46761828
N-[3-[acetyl(methyl)amino]phenyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 46761828) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[3-[acetyl(methyl)amino]phenyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[3-[acetyl(methyl)amino]phenyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 46761828 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[3-[acetyl(methyl)amino]phenyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1cccc(N(C)C(C)=O)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-13(21)20(2)15-8-6-7-14(11-15)19-18(22)12-24-17-10-5-4-9-16(17)23-3/h4-11H,12H2,1-3H3,(H,19,22) |
| InChIKey | MPTWQLNUWLBNLB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |