C23H30N2O3S — CID 32545458
3-[4-(methylsulfamoyl)phenyl]-N-[(1-phenylcyclohexyl)methyl]propanamide (PubChem CID 32545458) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is 3-[4-(methylsulfamoyl)phenyl]-N-[(1-phenylcyclohexyl)methyl]propanamide.
| Compound Name | 3-[4-(methylsulfamoyl)phenyl]-N-[(1-phenylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 32545458 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[4-(methylsulfamoyl)phenyl]-N-[(1-phenylcyclohexyl)methyl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)NCC2(c3ccccc3)CCCCC2)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-24-29(27,28)21-13-10-19(11-14-21)12-15-22(26)25-18-23(16-6-3-7-17-23)20-8-4-2-5-9-20/h2,4-5,8-11,13-14,24H,3,6-7,12,15-18H2,1H3,(H,25,26) |
| InChIKey | BNBFFIDKDVPRQR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |