About 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide
3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide (PubChem CID 105434539) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide.
Molecular Properties
| Compound Name | 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide |
| PubChem CID | 105434539 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide |
| SMILES | CN1CCN=C1NCCC(N)=O |
| InChI | InChI=1S/C7H14N4O/c1-11-5-4-10-7(11)9-3-2-6(8)12/h2-5H2,1H3,(H2,8,12)(H,9,10) |
| InChIKey | YPYRUKKJAQXVBN-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide?
The IUPAC name of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide (CID 105434539) is 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide.
What is the SMILES notation for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide?
The canonical SMILES for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide is CN1CCN=C1NCCC(N)=O.
What is the InChIKey of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide?
The InChIKey is YPYRUKKJAQXVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-11-5-4-10-7(11)9-3-2-6(8)12/h2-5H2,1H3,(H2,8,12)(H,9,10).
What are the key properties of 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide?
3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide has a molecular weight of 170.22 g/mol, XLogP of -1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]propanamide is sourced from PubChem (CID 105434539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).