C13H26N4O4 — CID 176535762
(2R)-2-(3-carbamimidamidopropyl)-3-imino-6-(2-methoxyethoxy)hexanoic acid (PubChem CID 176535762) has the molecular formula C13H26N4O4 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R)-2-(3-carbamimidamidopropyl)-3-imino-6-(2-methoxyethoxy)hexanoic acid.
| Compound Name | (2R)-2-(3-carbamimidamidopropyl)-3-imino-6-(2-methoxyethoxy)hexanoic acid |
|---|---|
| PubChem CID | 176535762 |
| Molecular Formula | C13H26N4O4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2R)-2-(3-carbamimidamidopropyl)-3-imino-6-(2-methoxyethoxy)hexanoic acid |
| SMILES | [H]/N=C(\N)NCCC[C@@H](C(=O)O)/C(CCCOCCOC)=N/[H] |
| InChI | InChI=1S/C13H26N4O4/c1-20-8-9-21-7-3-5-11(14)10(12(18)19)4-2-6-17-13(15)16/h10,14H,2-9H2,1H3,(H,18,19)(H4,15,16,17)/b14-11+/t10-/m1/s1 |
| InChIKey | UEWSTNHWCGNJHT-PIYPRNMZSA-N |
| XLogP | 0.41 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|