About 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide
2-carbamimidamidoethyl carbamimidothioate;dihydrobromide (PubChem CID 176518669) has the molecular formula C4H13Br2N5S
and a molecular weight of 323.06 g/mol. Its IUPAC name is 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide.
Molecular Properties
| Compound Name | 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide |
| PubChem CID | 176518669 |
| Molecular Formula | C4H13Br2N5S |
| Molecular Weight | 323.06 g/mol |
| Exact Mass | 320.93 |
| IUPAC Name | 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)NCCS/C(N)=N/[H] |
| InChI | InChI=1S/C4H11N5S.2BrH/c5-3(6)9-1-2-10-4(7)8;;/h1-2H2,(H3,7,8)(H4,5,6,9);2*1H |
| InChIKey | GPWJSTKHQMIXCA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.06 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide?
The IUPAC name of 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide (CID 176518669) is 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide.
What is the SMILES notation for 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide?
The canonical SMILES for 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide is Br.Br.[H]/N=C(\N)NCCS/C(N)=N/[H].
What is the InChIKey of 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide?
The InChIKey is GPWJSTKHQMIXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5S.2BrH/c5-3(6)9-1-2-10-4(7)8;;/h1-2H2,(H3,7,8)(H4,5,6,9);2*1H.
What are the key properties of 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide?
2-carbamimidamidoethyl carbamimidothioate;dihydrobromide has a molecular weight of 323.06 g/mol, XLogP of 0.25, 3 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamimidamidoethyl carbamimidothioate;dihydrobromide is sourced from PubChem (CID 176518669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).