C15H33N7O — CID 176527557
N-(3-carbamimidamidopropyl)-N-[3-(diaminomethylideneamino)propyl]-4,4-dimethylpentanamide (PubChem CID 176527557) has the molecular formula C15H33N7O and a molecular weight of 327.48 g/mol. Its IUPAC name is N-(3-carbamimidamidopropyl)-N-[3-(diaminomethylideneamino)propyl]-4,4-dimethylpentanamide.
| Compound Name | N-(3-carbamimidamidopropyl)-N-[3-(diaminomethylideneamino)propyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 176527557 |
| Molecular Formula | C15H33N7O |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | N-(3-carbamimidamidopropyl)-N-[3-(diaminomethylideneamino)propyl]-4,4-dimethylpentanamide |
| SMILES | [H]/N=C(\N)NCCCN(CCCN=C(N)N)C(=O)CCC(C)(C)C |
| InChI | InChI=1S/C15H33N7O/c1-15(2,3)7-6-12(23)22(10-4-8-20-13(16)17)11-5-9-21-14(18)19/h4-11H2,1-3H3,(H4,16,17,20)(H4,18,19,21) |
| InChIKey | IUVPGQNSYKBVEC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|