C27H54N8O4 — CID 11226685
N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(pentanoylamino)propyl]butanediamide (PubChem CID 11226685) has the molecular formula C27H54N8O4 and a molecular weight of 554.78 g/mol. Its IUPAC name is N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(pentanoylamino)propyl]butanediamide.
| Compound Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(pentanoylamino)propyl]butanediamide |
|---|---|
| PubChem CID | 11226685 |
| Molecular Formula | C27H54N8O4 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(pentanoylamino)propyl]butanediamide |
| SMILES | CCCCC(=O)NCCCN(CCCNC(=O)CCCC)C(=O)CCC(=O)NCCCNCCCN=C(N)N |
| InChI | InChI=1S/C27H54N8O4/c1-3-5-11-23(36)32-19-9-21-35(22-10-20-33-24(37)12-6-4-2)26(39)14-13-25(38)31-17-7-15-30-16-8-18-34-27(28)29/h30H,3-22H2,1-2H3,(H,31,38)(H,32,36)(H,33,37)(H4,28,29,34) |
| InChIKey | XOBFOCVHOZIFGC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|