C43H87F3N14O3 — CID 176545449
1-(8-carbamimidamidooctyl)-3-[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]-1,3-bis[8-(diaminomethylideneamino)octyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 176545449) has the molecular formula C43H87F3N14O3 and a molecular weight of 905.26 g/mol. Its IUPAC name is 1-(8-carbamimidamidooctyl)-3-[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]-1,3-bis[8-(diaminomethylideneamino)octyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(8-carbamimidamidooctyl)-3-[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]-1,3-bis[8-(diaminomethylideneamino)octyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 176545449 |
| Molecular Formula | C43H87F3N14O3 |
| Molecular Weight | 905.26 g/mol |
| Exact Mass | 904.70 |
| IUPAC Name | 1-(8-carbamimidamidooctyl)-3-[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]-1,3-bis[8-(diaminomethylideneamino)octyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)NCCCCCCCCN(CCCCCCCCN=C(N)N)C(=O)N(CCCCCCCCN=C(N)N)CCCCCCCCN/C(N)=N/CC1CC1 |
| InChI | InChI=1S/C41H86N14O.C2HF3O2/c42-37(43)49-27-17-9-1-5-13-21-31-54(32-22-14-6-2-10-18-28-50-38(44)45)41(56)55(33-23-15-7-3-11-19-29-51-39(46)47)34-24-16-8-4-12-20-30-52-40(48)53-35-36-25-26-36;3-2(4,5)1(6)7/h36H,1-35H2,(H4,42,43,49)(H4,44,45,50)(H4,46,47,51)(H3,48,52,53);(H,6,7) |
| InChIKey | XRRPGWAZPGFFQM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 301.96 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.26 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|