C19H38F3N7O4 — CID 174425986
N'-[4-(3-aminobutylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]oxamide;2,2,2-trifluoroacetic acid (PubChem CID 174425986) has the molecular formula C19H38F3N7O4 and a molecular weight of 485.55 g/mol. Its IUPAC name is N'-[4-(3-aminobutylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]oxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-[4-(3-aminobutylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]oxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174425986 |
| Molecular Formula | C19H38F3N7O4 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | N'-[4-(3-aminobutylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]oxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(N)CCNCCCCN(CCCCCCN=C(N)N)C(=O)C(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H37N7O2.C2HF3O2/c1-14(18)8-11-22-9-5-7-13-24(16(26)15(19)25)12-6-3-2-4-10-23-17(20)21;3-2(4,5)1(6)7/h14,22H,2-13,18H2,1H3,(H2,19,25)(H4,20,21,23);(H,6,7) |
| InChIKey | AOHCHJNALBRCCS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 203.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|