C29H61N5O2 — CID 57092723
[3-[3-(diaminomethylideneamino)propylamino]-1-(didecylamino)propyl] acetate (PubChem CID 57092723) has the molecular formula C29H61N5O2 and a molecular weight of 511.84 g/mol. Its IUPAC name is [3-[3-(diaminomethylideneamino)propylamino]-1-(didecylamino)propyl] acetate.
| Compound Name | [3-[3-(diaminomethylideneamino)propylamino]-1-(didecylamino)propyl] acetate |
|---|---|
| PubChem CID | 57092723 |
| Molecular Formula | C29H61N5O2 |
| Molecular Weight | 511.84 g/mol |
| Exact Mass | 511.48 |
| IUPAC Name | [3-[3-(diaminomethylideneamino)propylamino]-1-(didecylamino)propyl] acetate |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(CCNCCCN=C(N)N)OC(C)=O |
| InChI | InChI=1S/C29H61N5O2/c1-4-6-8-10-12-14-16-18-25-34(26-19-17-15-13-11-9-7-5-2)28(36-27(3)35)21-24-32-22-20-23-33-29(30)31/h28,32H,4-26H2,1-3H3,(H4,30,31,33) |
| InChIKey | MRZDAAVPKFWULV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.84 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|