C20H43N7O3 — CID 19043112
N-[4-(3-aminobutylamino)butyl]-N'-[8-(diaminomethylideneamino)octyl]-2-hydroxypropanediamide (PubChem CID 19043112) has the molecular formula C20H43N7O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is N-[4-(3-aminobutylamino)butyl]-N'-[8-(diaminomethylideneamino)octyl]-2-hydroxypropanediamide.
| Compound Name | N-[4-(3-aminobutylamino)butyl]-N'-[8-(diaminomethylideneamino)octyl]-2-hydroxypropanediamide |
|---|---|
| PubChem CID | 19043112 |
| Molecular Formula | C20H43N7O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | N-[4-(3-aminobutylamino)butyl]-N'-[8-(diaminomethylideneamino)octyl]-2-hydroxypropanediamide |
| SMILES | CC(N)CCNCCCCNC(=O)C(O)C(=O)NCCCCCCCCN=C(N)N |
| InChI | InChI=1S/C20H43N7O3/c1-16(21)10-15-24-11-8-9-13-26-19(30)17(28)18(29)25-12-6-4-2-3-5-7-14-27-20(22)23/h16-17,24,28H,2-15,21H2,1H3,(H,25,29)(H,26,30)(H4,22,23,27) |
| InChIKey | PDRCTRFSHJZCPA-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 180.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|