C13H22N4O4S — CID 19785366
2-N-(2-methoxyethyl)-4,5-dihydroimidazole-1,2-diamine;4-methylbenzenesulfonic acid (PubChem CID 19785366) has the molecular formula C13H22N4O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-4,5-dihydroimidazole-1,2-diamine;4-methylbenzenesulfonic acid.
| Compound Name | 2-N-(2-methoxyethyl)-4,5-dihydroimidazole-1,2-diamine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19785366 |
| Molecular Formula | C13H22N4O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-N-(2-methoxyethyl)-4,5-dihydroimidazole-1,2-diamine;4-methylbenzenesulfonic acid |
| SMILES | COCCNC1=NCCN1N.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H14N4O/c1-6-2-4-7(5-3-6)11(8,9)10;1-11-5-3-9-6-8-2-4-10(6)7/h2-5H,1H3,(H,8,9,10);2-5,7H2,1H3,(H,8,9) |
| InChIKey | JCTQZMOSROCNAL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|