C8H20N6O3 — CID 176523607
3-carbamimidoyl-1,1,2-triethylguanidine;nitric acid (PubChem CID 176523607) has the molecular formula C8H20N6O3 and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-carbamimidoyl-1,1,2-triethylguanidine;nitric acid.
| Compound Name | 3-carbamimidoyl-1,1,2-triethylguanidine;nitric acid |
|---|---|
| PubChem CID | 176523607 |
| Molecular Formula | C8H20N6O3 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 3-carbamimidoyl-1,1,2-triethylguanidine;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N/C(=N/CC)N(CC)CC |
| InChI | InChI=1S/C8H19N5.HNO3/c1-4-11-8(12-7(9)10)13(5-2)6-3;2-1(3)4/h4-6H2,1-3H3,(H4,9,10,11,12);(H,2,3,4) |
| InChIKey | GDRQZRNRJFTTLA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|