C15H30Cl2N6O5 — CID 71472255
ethyl (2R,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate;dihydrochloride (PubChem CID 71472255) has the molecular formula C15H30Cl2N6O5 and a molecular weight of 445.35 g/mol. Its IUPAC name is ethyl (2R,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate;dihydrochloride.
| Compound Name | ethyl (2R,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 71472255 |
| Molecular Formula | C15H30Cl2N6O5 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | ethyl (2R,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)[C@H]1C[C@H](C)CCN1C(=O)[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C15H28N6O5.2ClH/c1-3-26-14(23)12-9-10(2)6-8-20(12)13(22)11(16)5-4-7-18-15(17)19-21(24)25;;/h10-12H,3-9,16H2,1-2H3,(H3,17,18,19);2*1H/t10-,11+,12-;;/m1../s1 |
| InChIKey | BLXNHCCOAAFKDQ-MEEFYBHTSA-N |
| XLogP | 0.22 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|