C18H35N7O5 — CID 67639889
ethyl 6-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]hexanoate (PubChem CID 67639889) has the molecular formula C18H35N7O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 6-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]hexanoate.
| Compound Name | ethyl 6-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]hexanoate |
|---|---|
| PubChem CID | 67639889 |
| Molecular Formula | C18H35N7O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | ethyl 6-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCN1CCN(C(=O)[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H35N7O5/c1-2-30-16(26)8-4-3-5-10-23-11-13-24(14-12-23)17(27)15(19)7-6-9-21-18(20)22-25(28)29/h15H,2-14,19H2,1H3,(H3,20,21,22)/t15-/m0/s1 |
| InChIKey | XCCBLCGCDGRVJQ-HNNXBMFYSA-N |
| XLogP | -0.54 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|