C14H27N7O5 — CID 160689363
4-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]butanoic acid (PubChem CID 160689363) has the molecular formula C14H27N7O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]butanoic acid.
| Compound Name | 4-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 160689363 |
| Molecular Formula | C14H27N7O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 4-[4-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]piperazin-1-yl]butanoic acid |
| SMILES | N/C(=N\CCC[C@H](N)C(=O)N1CCN(CCCC(=O)O)CC1)N[N+](=O)[O-] |
| InChI | InChI=1S/C14H27N7O5/c15-11(3-1-5-17-14(16)18-21(25)26)13(24)20-9-7-19(8-10-20)6-2-4-12(22)23/h11H,1-10,15H2,(H,22,23)(H3,16,17,18)/t11-/m0/s1 |
| InChIKey | RPEYYWJRMHJMFO-NSHDSACASA-N |
| XLogP | -1.80 |
| TPSA | 180.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|