C11H20N4O4 — CID 61162188
3-[4-(2,4-diamino-4-oxobutanoyl)piperazin-1-yl]propanoic acid (PubChem CID 61162188) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-[4-(2,4-diamino-4-oxobutanoyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(2,4-diamino-4-oxobutanoyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 61162188 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-[4-(2,4-diamino-4-oxobutanoyl)piperazin-1-yl]propanoic acid |
| SMILES | NC(=O)CC(N)C(=O)N1CCN(CCC(=O)O)CC1 |
| InChI | InChI=1S/C11H20N4O4/c12-8(7-9(13)16)11(19)15-5-3-14(4-6-15)2-1-10(17)18/h8H,1-7,12H2,(H2,13,16)(H,17,18) |
| InChIKey | QFCMIIFBYSGMNS-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |