C11H20N4O4 — CID 54916787
ethyl 4-(2,4-diamino-4-oxobutanoyl)piperazine-1-carboxylate (PubChem CID 54916787) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is ethyl 4-(2,4-diamino-4-oxobutanoyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,4-diamino-4-oxobutanoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54916787 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | ethyl 4-(2,4-diamino-4-oxobutanoyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(N)CC(N)=O)CC1 |
| InChI | InChI=1S/C11H20N4O4/c1-2-19-11(18)15-5-3-14(4-6-15)10(17)8(12)7-9(13)16/h8H,2-7,12H2,1H3,(H2,13,16) |
| InChIKey | BAZLQYRSIFQIFW-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |