C12H21N3O4 — CID 60846566
ethyl 1-(2,4-diamino-4-oxobutanoyl)piperidine-4-carboxylate (PubChem CID 60846566) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is ethyl 1-(2,4-diamino-4-oxobutanoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2,4-diamino-4-oxobutanoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 60846566 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | ethyl 1-(2,4-diamino-4-oxobutanoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(N)CC(N)=O)CC1 |
| InChI | InChI=1S/C12H21N3O4/c1-2-19-12(18)8-3-5-15(6-4-8)11(17)9(13)7-10(14)16/h8-9H,2-7,13H2,1H3,(H2,14,16) |
| InChIKey | GVJPGVXOTGSTHF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |