C15H30N3O6P — CID 87456486
ethyl 4-[(2S)-2-amino-4-diethoxyphosphorylbutanoyl]piperazine-1-carboxylate (PubChem CID 87456486) has the molecular formula C15H30N3O6P and a molecular weight of 379.39 g/mol. Its IUPAC name is ethyl 4-[(2S)-2-amino-4-diethoxyphosphorylbutanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2S)-2-amino-4-diethoxyphosphorylbutanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87456486 |
| Molecular Formula | C15H30N3O6P |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | ethyl 4-[(2S)-2-amino-4-diethoxyphosphorylbutanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@@H](N)CCP(=O)(OCC)OCC)CC1 |
| InChI | InChI=1S/C15H30N3O6P/c1-4-22-15(20)18-10-8-17(9-11-18)14(19)13(16)7-12-25(21,23-5-2)24-6-3/h13H,4-12,16H2,1-3H3/t13-/m0/s1 |
| InChIKey | WOHKFNSREBNOKJ-ZDUSSCGKSA-N |
| XLogP | 1.27 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|