C16H33ClN3O6P — CID 174603531
5-[4-[(2R)-2-amino-3-diethoxyphosphorylpropanoyl]piperazin-1-yl]pentanoic acid;hydrochloride (PubChem CID 174603531) has the molecular formula C16H33ClN3O6P and a molecular weight of 429.88 g/mol. Its IUPAC name is 5-[4-[(2R)-2-amino-3-diethoxyphosphorylpropanoyl]piperazin-1-yl]pentanoic acid;hydrochloride.
| Compound Name | 5-[4-[(2R)-2-amino-3-diethoxyphosphorylpropanoyl]piperazin-1-yl]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 174603531 |
| Molecular Formula | C16H33ClN3O6P |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 5-[4-[(2R)-2-amino-3-diethoxyphosphorylpropanoyl]piperazin-1-yl]pentanoic acid;hydrochloride |
| SMILES | CCOP(=O)(C[C@H](N)C(=O)N1CCN(CCCCC(=O)O)CC1)OCC.Cl |
| InChI | InChI=1S/C16H32N3O6P.ClH/c1-3-24-26(23,25-4-2)13-14(17)16(22)19-11-9-18(10-12-19)8-6-5-7-15(20)21;/h14H,3-13,17H2,1-2H3,(H,20,21);1H/t14-;/m0./s1 |
| InChIKey | BYQGRVCWEPTSMG-UQKRIMTDSA-N |
| XLogP | 1.40 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|