C20H35N3O5 — CID 174709056
5-[4-[2-[amino(cyclopropyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]piperazin-1-yl]pentanoic acid (PubChem CID 174709056) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is 5-[4-[2-[amino(cyclopropyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]piperazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-[2-[amino(cyclopropyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 174709056 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 5-[4-[2-[amino(cyclopropyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]piperazin-1-yl]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)C(C(=O)N1CCN(CCCCC(=O)O)CC1)C(N)C1CC1 |
| InChI | InChI=1S/C20H35N3O5/c1-20(2,3)28-19(27)16(17(21)14-7-8-14)18(26)23-12-10-22(11-13-23)9-5-4-6-15(24)25/h14,16-17H,4-13,21H2,1-3H3,(H,24,25) |
| InChIKey | UMKWRWIJRRXQGV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|