C18H30N3O4P — CID 174618701
2-amino-3-[4-(diethoxyphosphorylmethyl)phenyl]-1-piperazin-1-ylpropan-1-one (PubChem CID 174618701) has the molecular formula C18H30N3O4P and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-amino-3-[4-(diethoxyphosphorylmethyl)phenyl]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 2-amino-3-[4-(diethoxyphosphorylmethyl)phenyl]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 174618701 |
| Molecular Formula | C18H30N3O4P |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-amino-3-[4-(diethoxyphosphorylmethyl)phenyl]-1-piperazin-1-ylpropan-1-one |
| SMILES | CCOP(=O)(Cc1ccc(CC(N)C(=O)N2CCNCC2)cc1)OCC |
| InChI | InChI=1S/C18H30N3O4P/c1-3-24-26(23,25-4-2)14-16-7-5-15(6-8-16)13-17(19)18(22)21-11-9-20-10-12-21/h5-8,17,20H,3-4,9-14,19H2,1-2H3 |
| InChIKey | GXCBZWHHGXTMSQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|