C10H20N4O3 — CID 107877194
ethyl 4-(2,3-diamino-3-oxopropyl)piperazine-1-carboxylate (PubChem CID 107877194) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl 4-(2,3-diamino-3-oxopropyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,3-diamino-3-oxopropyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 107877194 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | ethyl 4-(2,3-diamino-3-oxopropyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(N)C(N)=O)CC1 |
| InChI | InChI=1S/C10H20N4O3/c1-2-17-10(16)14-5-3-13(4-6-14)7-8(11)9(12)15/h8H,2-7,11H2,1H3,(H2,12,15) |
| InChIKey | PWNGHNBXLFSFCF-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |