About tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate
tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate (PubChem CID 114518384) has the molecular formula C13H26N4O3
and a molecular weight of 286.38 g/mol. Its IUPAC name is tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate |
| PubChem CID | 114518384 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(CC(N)C(N)=O)CC1 |
| InChI | InChI=1S/C13H26N4O3/c1-13(2,3)20-12(19)17-6-4-5-16(7-8-17)9-10(14)11(15)18/h10H,4-9,14H2,1-3H3,(H2,15,18) |
| InChIKey | YGKCHDDIDLFFBC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate?
The IUPAC name of tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate (CID 114518384) is tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate?
The canonical SMILES for tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate is CC(C)(C)OC(=O)N1CCCN(CC(N)C(N)=O)CC1.
What is the InChIKey of tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate?
The InChIKey is YGKCHDDIDLFFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O3/c1-13(2,3)20-12(19)17-6-4-5-16(7-8-17)9-10(14)11(15)18/h10H,4-9,14H2,1-3H3,(H2,15,18).
What are the key properties of tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate?
tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate has a molecular weight of 286.38 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2,3-diamino-3-oxopropyl)-1,4-diazepane-1-carboxylate is sourced from PubChem (CID 114518384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).