C14H21N5O2 — CID 60938311
3-amino-4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanamide (PubChem CID 60938311) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 3-amino-4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanamide.
| Compound Name | 3-amino-4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 60938311 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-amino-4-oxo-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]butanamide |
| SMILES | NC(=O)CC(N)C(=O)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C14H21N5O2/c15-12(9-13(16)20)14(21)19-7-5-18(6-8-19)10-11-1-3-17-4-2-11/h1-4,12H,5-10,15H2,(H2,16,20) |
| InChIKey | SROOMKDGJKWLFM-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |