C11H22N8O4 — CID 73354378
(2S,4R)-4-amino-1-[(2R)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]pyrrolidine-2-carboxamide (PubChem CID 73354378) has the molecular formula C11H22N8O4 and a molecular weight of 330.35 g/mol. Its IUPAC name is (2S,4R)-4-amino-1-[(2R)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-1-[(2R)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 73354378 |
| Molecular Formula | C11H22N8O4 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2S,4R)-4-amino-1-[(2R)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H](N)CN1C(=O)[C@H](N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C11H22N8O4/c12-6-4-8(9(14)20)18(5-6)10(21)7(13)2-1-3-16-11(15)17-19(22)23/h6-8H,1-5,12-13H2,(H2,14,20)(H3,15,16,17)/t6-,7-,8+/m1/s1 |
| InChIKey | QLHNGUCBVCLFHA-PRJMDXOYSA-N |
| XLogP | -3.40 |
| TPSA | 208.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|