C33H34N4O5S — CID 134304852
[(Z)-[amino-[3-[(2S)-2-(naphthalen-2-ylsulfonylamino)-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]phenyl]methylidene]amino] acetate (PubChem CID 134304852) has the molecular formula C33H34N4O5S and a molecular weight of 598.73 g/mol. Its IUPAC name is [(Z)-[amino-[3-[(2S)-2-(naphthalen-2-ylsulfonylamino)-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]phenyl]methylidene]amino] acetate.
| Compound Name | [(Z)-[amino-[3-[(2S)-2-(naphthalen-2-ylsulfonylamino)-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 134304852 |
| Molecular Formula | C33H34N4O5S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | [(Z)-[amino-[3-[(2S)-2-(naphthalen-2-ylsulfonylamino)-3-oxo-3-(4-phenylpiperidin-1-yl)propyl]phenyl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N2CCC(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C33H34N4O5S/c1-23(38)42-35-32(34)29-13-7-8-24(20-29)21-31(33(39)37-18-16-27(17-19-37)25-9-3-2-4-10-25)36-43(40,41)30-15-14-26-11-5-6-12-28(26)22-30/h2-15,20,22,27,31,36H,16-19,21H2,1H3,(H2,34,35)/t31-/m0/s1 |
| InChIKey | DGPIIHBQMXEJLE-HKBQPEDESA-N |
| XLogP | 4.32 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|