C28H30Cl2N6O5S — CID 71496422
ethyl 4-[(3-carbamimidoylphenyl)methyl-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]carbamoyl]piperazine-1-carboxylate (PubChem CID 71496422) has the molecular formula C28H30Cl2N6O5S and a molecular weight of 633.56 g/mol. Its IUPAC name is ethyl 4-[(3-carbamimidoylphenyl)methyl-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]carbamoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(3-carbamimidoylphenyl)methyl-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71496422 |
| Molecular Formula | C28H30Cl2N6O5S |
| Molecular Weight | 633.56 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | ethyl 4-[(3-carbamimidoylphenyl)methyl-[[3-(2,4-dichlorophenyl)phenyl]sulfonylamino]carbamoyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(CN(NS(=O)(=O)c2cccc(-c3ccc(Cl)cc3Cl)c2)C(=O)N2CCN(C(=O)OCC)CC2)c1 |
| InChI | InChI=1S/C28H30Cl2N6O5S/c1-2-41-28(38)35-13-11-34(12-14-35)27(37)36(18-19-5-3-7-21(15-19)26(31)32)33-42(39,40)23-8-4-6-20(16-23)24-10-9-22(29)17-25(24)30/h3-10,15-17,33H,2,11-14,18H2,1H3,(H3,31,32) |
| InChIKey | KHBXUTUNFDXHRT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|