C22H21N3O4S — CID 20666648
2-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]-5-(pyridin-3-ylsulfonylamino)benzamide (PubChem CID 20666648) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]-5-(pyridin-3-ylsulfonylamino)benzamide.
| Compound Name | 2-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]-5-(pyridin-3-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 20666648 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]-5-(pyridin-3-ylsulfonylamino)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccnc2)cc1C(=O)N[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H21N3O4S/c1-16-9-10-18(25-30(28,29)20-8-5-11-23-14-20)13-21(16)22(27)24-19(15-26)12-17-6-3-2-4-7-17/h2-11,13-15,19,25H,12H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | FWDHOJRQXZCALC-IBGZPJMESA-N |
| XLogP | 2.73 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|