C10H12N2O2 — CID 21464846
N-(1-oxo-3-pyridin-3-ylpropan-2-yl)acetamide (PubChem CID 21464846) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(1-oxo-3-pyridin-3-ylpropan-2-yl)acetamide.
| Compound Name | N-(1-oxo-3-pyridin-3-ylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 21464846 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-(1-oxo-3-pyridin-3-ylpropan-2-yl)acetamide |
| SMILES | CC(=O)NC(C=O)Cc1cccnc1 |
| InChI | InChI=1S/C10H12N2O2/c1-8(14)12-10(7-13)5-9-3-2-4-11-6-9/h2-4,6-7,10H,5H2,1H3,(H,12,14) |
| InChIKey | KUPMNRYNBQSSOW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|