C10H12Cl3N3O — CID 780039
N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]acetamide (PubChem CID 780039) has the molecular formula C10H12Cl3N3O and a molecular weight of 296.59 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]acetamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 780039 |
| Molecular Formula | C10H12Cl3N3O |
| Molecular Weight | 296.59 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]acetamide |
| SMILES | CC(=O)N[C@H](NCc1cccnc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3N3O/c1-7(17)16-9(10(11,12)13)15-6-8-3-2-4-14-5-8/h2-5,9,15H,6H2,1H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | CCJXRFHKMPDDQR-VIFPVBQESA-N |
| XLogP | 2.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|