C16H16Cl3N3O — CID 3104208
2-methyl-N-[2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]benzamide (PubChem CID 3104208) has the molecular formula C16H16Cl3N3O and a molecular weight of 372.68 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]benzamide.
| Compound Name | 2-methyl-N-[2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 3104208 |
| Molecular Formula | C16H16Cl3N3O |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-methyl-N-[2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(NCc1cccnc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H16Cl3N3O/c1-11-5-2-3-7-13(11)14(23)22-15(16(17,18)19)21-10-12-6-4-8-20-9-12/h2-9,15,21H,10H2,1H3,(H,22,23) |
| InChIKey | OOQLYUIEUWGLRU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|