C11H14Cl3N3O — CID 821626
N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]propanamide (PubChem CID 821626) has the molecular formula C11H14Cl3N3O and a molecular weight of 310.61 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]propanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 821626 |
| Molecular Formula | C11H14Cl3N3O |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(pyridin-3-ylmethylamino)ethyl]propanamide |
| SMILES | CCC(=O)N[C@H](NCc1cccnc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl3N3O/c1-2-9(18)17-10(11(12,13)14)16-7-8-4-3-5-15-6-8/h3-6,10,16H,2,7H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | LEYHQNULVWKOIE-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|