C18H18INO2 — CID 173354070
3-iodo-N-[(2R)-1-oxo-5-phenylpentan-2-yl]benzamide (PubChem CID 173354070) has the molecular formula C18H18INO2 and a molecular weight of 407.25 g/mol. Its IUPAC name is 3-iodo-N-[(2R)-1-oxo-5-phenylpentan-2-yl]benzamide.
| Compound Name | 3-iodo-N-[(2R)-1-oxo-5-phenylpentan-2-yl]benzamide |
|---|---|
| PubChem CID | 173354070 |
| Molecular Formula | C18H18INO2 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 3-iodo-N-[(2R)-1-oxo-5-phenylpentan-2-yl]benzamide |
| SMILES | O=C[C@@H](CCCc1ccccc1)NC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C18H18INO2/c19-16-10-5-9-15(12-16)18(22)20-17(13-21)11-4-8-14-6-2-1-3-7-14/h1-3,5-7,9-10,12-13,17H,4,8,11H2,(H,20,22)/t17-/m1/s1 |
| InChIKey | JQEVXQRKVGXWDU-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|