About 3-iodobenzoate;3-phenylpropylazanium
3-iodobenzoate;3-phenylpropylazanium (PubChem CID 139060545) has the molecular formula C16H18INO2
and a molecular weight of 383.23 g/mol. Its IUPAC name is 3-iodobenzoate;3-phenylpropylazanium.
Molecular Properties
| Compound Name | 3-iodobenzoate;3-phenylpropylazanium |
| PubChem CID | 139060545 |
| Molecular Formula | C16H18INO2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 3-iodobenzoate;3-phenylpropylazanium |
| SMILES | O=C([O-])c1cccc(I)c1.[NH3+]CCCc1ccccc1 |
| InChI | InChI=1S/C9H13N.C7H5IO2/c10-8-4-7-9-5-2-1-3-6-9;8-6-3-1-2-5(4-6)7(9)10/h1-3,5-6H,4,7-8,10H2;1-4H,(H,9,10) |
| InChIKey | GERVAGLQRLVAAE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodobenzoate;3-phenylpropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodobenzoate;3-phenylpropylazanium?
The IUPAC name of 3-iodobenzoate;3-phenylpropylazanium (CID 139060545) is 3-iodobenzoate;3-phenylpropylazanium.
What is the SMILES notation for 3-iodobenzoate;3-phenylpropylazanium?
The canonical SMILES for 3-iodobenzoate;3-phenylpropylazanium is O=C([O-])c1cccc(I)c1.[NH3+]CCCc1ccccc1.
What is the InChIKey of 3-iodobenzoate;3-phenylpropylazanium?
The InChIKey is GERVAGLQRLVAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C7H5IO2/c10-8-4-7-9-5-2-1-3-6-9;8-6-3-1-2-5(4-6)7(9)10/h1-3,5-6H,4,7-8,10H2;1-4H,(H,9,10).
What are the key properties of 3-iodobenzoate;3-phenylpropylazanium?
3-iodobenzoate;3-phenylpropylazanium has a molecular weight of 383.23 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodobenzoate;3-phenylpropylazanium is sourced from PubChem (CID 139060545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).