C28H25NO2 — CID 20666644
N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2-[(E)-2-naphthalen-2-ylethenyl]benzamide (PubChem CID 20666644) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2-[(E)-2-naphthalen-2-ylethenyl]benzamide.
| Compound Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2-[(E)-2-naphthalen-2-ylethenyl]benzamide |
|---|---|
| PubChem CID | 20666644 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2-[(E)-2-naphthalen-2-ylethenyl]benzamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)c1ccccc1/C=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H25NO2/c30-20-26(19-21-8-2-1-3-9-21)29-28(31)27-13-7-6-11-24(27)17-15-22-14-16-23-10-4-5-12-25(23)18-22/h1-18,26,30H,19-20H2,(H,29,31)/b17-15+/t26-/m0/s1 |
| InChIKey | VFWVPOAPHMNGQQ-DSDNZOFKSA-N |
| XLogP | 5.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|