C26H25NO4 — CID 20666642
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 20666642) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 20666642 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-N-[(2S)-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | COc1ccc(/C=C/c2ccccc2C(=O)N[C@H](C=O)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H25NO4/c1-30-24-15-13-20(17-25(24)31-2)12-14-21-10-6-7-11-23(21)26(29)27-22(18-28)16-19-8-4-3-5-9-19/h3-15,17-18,22H,16H2,1-2H3,(H,27,29)/b14-12+/t22-/m0/s1 |
| InChIKey | BUWSNTLOUSDRAJ-VKXNWWILSA-N |
| XLogP | 4.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|