C17H16ClNO3 — CID 153385786
5-chloro-2-methoxy-N-(1-oxo-3-phenylpropan-2-yl)benzamide (PubChem CID 153385786) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(1-oxo-3-phenylpropan-2-yl)benzamide.
| Compound Name | 5-chloro-2-methoxy-N-(1-oxo-3-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 153385786 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-chloro-2-methoxy-N-(1-oxo-3-phenylpropan-2-yl)benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H16ClNO3/c1-22-16-8-7-13(18)10-15(16)17(21)19-14(11-20)9-12-5-3-2-4-6-12/h2-8,10-11,14H,9H2,1H3,(H,19,21) |
| InChIKey | MUTVPQNSFVGGFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|