C19H20N2O2 — CID 21190834
N-(1-oxopentan-2-yl)-2-[(E)-2-pyridin-4-ylethenyl]benzamide (PubChem CID 21190834) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-(1-oxopentan-2-yl)-2-[(E)-2-pyridin-4-ylethenyl]benzamide.
| Compound Name | N-(1-oxopentan-2-yl)-2-[(E)-2-pyridin-4-ylethenyl]benzamide |
|---|---|
| PubChem CID | 21190834 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-(1-oxopentan-2-yl)-2-[(E)-2-pyridin-4-ylethenyl]benzamide |
| SMILES | CCCC(C=O)NC(=O)c1ccccc1/C=C/c1ccncc1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-5-17(14-22)21-19(23)18-7-4-3-6-16(18)9-8-15-10-12-20-13-11-15/h3-4,6-14,17H,2,5H2,1H3,(H,21,23)/b9-8+ |
| InChIKey | LOQZOHJDINJKFZ-CMDGGOBGSA-N |
| XLogP | 3.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|