C13H16BNO — CID 91112579
CID 91112579 (PubChem CID 91112579) has the molecular formula C13H16BNO and a molecular weight of 213.09 g/mol.
| Compound Name | CID 91112579 |
|---|---|
| PubChem CID | 91112579 |
| Molecular Formula | C13H16BNO |
| Molecular Weight | 213.09 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H](C=Cc1ccccc1)CCC |
| InChI | InChI=1S/C13H16BNO/c1-2-6-12(15-13(14)16)10-9-11-7-4-3-5-8-11/h3-5,7-10,12H,2,6H2,1H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | HZUVMEDWPZPEMZ-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.09 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|