C13H12Cl4N2O2 — CID 71443805
2,2-dichloro-N-[1-[(2,2-dichloroacetyl)amino]-3-phenylprop-2-enyl]acetamide (PubChem CID 71443805) has the molecular formula C13H12Cl4N2O2 and a molecular weight of 370.06 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-[(2,2-dichloroacetyl)amino]-3-phenylprop-2-enyl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-[(2,2-dichloroacetyl)amino]-3-phenylprop-2-enyl]acetamide |
|---|---|
| PubChem CID | 71443805 |
| Molecular Formula | C13H12Cl4N2O2 |
| Molecular Weight | 370.06 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 2,2-dichloro-N-[1-[(2,2-dichloroacetyl)amino]-3-phenylprop-2-enyl]acetamide |
| SMILES | O=C(NC(C=Cc1ccccc1)NC(=O)C(Cl)Cl)C(Cl)Cl |
| InChI | InChI=1S/C13H12Cl4N2O2/c14-10(15)12(20)18-9(19-13(21)11(16)17)7-6-8-4-2-1-3-5-8/h1-7,9-11H,(H,18,20)(H,19,21) |
| InChIKey | LRRQHHLDZCQUOV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.06 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|