C23H21NO2 — CID 138982001
(E,2S)-N-benzhydryl-2-hydroxy-4-phenylbut-3-enamide (PubChem CID 138982001) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (E,2S)-N-benzhydryl-2-hydroxy-4-phenylbut-3-enamide.
| Compound Name | (E,2S)-N-benzhydryl-2-hydroxy-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 138982001 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (E,2S)-N-benzhydryl-2-hydroxy-4-phenylbut-3-enamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H21NO2/c25-21(17-16-18-10-4-1-5-11-18)23(26)24-22(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17,21-22,25H,(H,24,26)/b17-16+/t21-/m0/s1 |
| InChIKey | WSIRKQHCWHDLST-PQORCFSTSA-N |
| XLogP | 3.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |