C14H14N2O2 — CID 89362802
N-(5-cyanopent-1-en-3-yl)-2-formylbenzamide (PubChem CID 89362802) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(5-cyanopent-1-en-3-yl)-2-formylbenzamide.
| Compound Name | N-(5-cyanopent-1-en-3-yl)-2-formylbenzamide |
|---|---|
| PubChem CID | 89362802 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(5-cyanopent-1-en-3-yl)-2-formylbenzamide |
| SMILES | C=CC(CCC#N)NC(=O)c1ccccc1C=O |
| InChI | InChI=1S/C14H14N2O2/c1-2-12(7-5-9-15)16-14(18)13-8-4-3-6-11(13)10-17/h2-4,6,8,10,12H,1,5,7H2,(H,16,18) |
| InChIKey | BZUUSYYNZNVWGF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|